The given chemical formula represents a complex compound consisting of uranium(VI) (UO2), iodide (I-), and a ligand molecule, C13H20N3O, which is likely a tris(2-aminoethyl)amine (TREN) derivative. In this complex, uranium(VI) is in the +6 oxidation state, forming a UO2(2+) cation, while iodide is in the -1 oxidation state as I(1-). The C13H20N3O ligand, which is a neutral molecule, coordinates to the uranium center through its nitrogen atoms, forming a UO2I(C13H20N3O) complex. UO2(2+)*I(1-)*C13H20N3O(1-)=UO2I(C13H20N3O) is an example of a metal-organic complex where the metal ion is stabilized by the coordination of the organic ligand, and the iodide ion is also coordinated to the uranium center, contributing to the overall stability and structure of the complex.
The CAS Registry Mumber 54974-91-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,9,7 and 4 respectively; the second part has 2 digits, 9 and 1 respectively. Calculate Digit Verification of CAS Registry Number 54974-91: (7*5)+(6*4)+(5*9)+(4*7)+(3*4)+(2*9)+(1*1)=163 163 % 10 = 3 So 54974-91-3 is a valid CAS Registry Number.