55044-68-3 Usage
Uses
Used in Organic Synthesis:
6-IODO-PYRIDINE-2-CARBOXYLIC ACID is used as a building block for the production of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and reactivity make it a valuable component in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
6-IODO-PYRIDINE-2-CARBOXYLIC ACID is used as an intermediate in the synthesis of drugs, contributing to the development of new medications and therapies. Its presence in the molecular structure of certain pharmaceuticals can enhance their efficacy and selectivity.
Used in Agrochemical Industry:
6-IODO-PYRIDINE-2-CARBOXYLIC ACID is used as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can improve their effectiveness in controlling pests and weeds, thereby supporting agricultural productivity.
Used in Material Science:
6-IODO-PYRIDINE-2-CARBOXYLIC ACID is used in the development of new materials, such as polymers and composites, due to its unique chemical properties. Its presence in these materials can enhance their performance characteristics, such as strength, stability, and reactivity.
Used in Research and Development:
6-IODO-PYRIDINE-2-CARBOXYLIC ACID is used as a research tool in the exploration of new chemical reactions and processes. Its unique properties make it an interesting subject for study, potentially leading to the discovery of novel applications and technologies.
Used in Advanced Technology Development:
6-IODO-PYRIDINE-2-CARBOXYLIC ACID plays a crucial role in the development of advanced technologies, such as sensors, imaging agents, and other specialized applications. Its unique properties and reactivity make it a valuable component in the creation of innovative solutions to various challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 55044-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,0,4 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 55044-68:
(7*5)+(6*5)+(5*0)+(4*4)+(3*4)+(2*6)+(1*8)=113
113 % 10 = 3
So 55044-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4INO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3H,(H,9,10)