55044-68-3 Usage
General Description
6-Iodo-pyridine-2-carboxylic acid is a chemical compound with the molecular formula C6H4INO2. It is a derivative of pyridine and carboxylic acid, containing an iodine atom, which gives it unique properties and reactivity. 6-IODO-PYRIDINE-2-CARBOXYLIC ACID is commonly used in organic synthesis as a building block for the production of various pharmaceuticals, agrochemicals, and other fine chemicals. It is also utilized in the development of new materials and in research and development applications. 6-Iodo-pyridine-2-carboxylic acid plays a crucial role in the development of advanced technologies and can be found in various chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 55044-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,0,4 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 55044-68:
(7*5)+(6*5)+(5*0)+(4*4)+(3*4)+(2*6)+(1*8)=113
113 % 10 = 3
So 55044-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4INO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3H,(H,9,10)
