55124-77-1 Usage
Uses
Used in Chemical Industry:
(1-Octylnonyl)cyclohexane is used as a solvent for various applications, including the production of fragrances, flavors, and pharmaceuticals. Its properties as a solvent make it suitable for dissolving and extracting different substances.
Used in Polymer Production:
(1-Octylnonyl)cyclohexane serves as a raw material in the manufacturing of polymers. Its chemical structure allows it to be incorporated into the polymer matrix, contributing to the desired properties of the final product.
Used in Pharmaceutical Industry:
As a component in the production of pharmaceuticals, (1-Octylnonyl)cyclohexane plays a role in the synthesis of various medicinal compounds, potentially aiding in the development of new drugs and therapies.
Used in Lubricant Industry:
(1-Octylnonyl)cyclohexane is utilized as a lubricant additive, enhancing the performance and longevity of lubricants used in various mechanical applications. Its ability to reduce friction and wear contributes to the efficiency and reliability of machinery.
It is important to handle and store (1-Octylnonyl)cyclohexane with care to prevent accidental exposure or release into the environment, ensuring the safety of both workers and the ecosystem.
Check Digit Verification of cas no
The CAS Registry Mumber 55124-77-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,1,2 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 55124-77:
(7*5)+(6*5)+(5*1)+(4*2)+(3*4)+(2*7)+(1*7)=111
111 % 10 = 1
So 55124-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H46/c1-3-5-7-9-11-14-18-22(23-20-16-13-17-21-23)19-15-12-10-8-6-4-2/h22-23H,3-21H2,1-2H3
