5513-66-6 Usage
Uses
Used in Pharmaceutical Industry:
4-amino-2-Piperidinone is used as an intermediate in the synthesis of various pharmaceuticals for its ability to be incorporated into the molecular structures of different drugs. Its presence in the compounds can enhance their therapeutic effects and target specific medical conditions.
Used in Agrochemical Industry:
4-amino-2-Piperidinone is used as an intermediate in the development of agrochemicals, such as pesticides and herbicides, due to its potential to improve the efficacy and selectivity of these chemicals in agricultural applications.
Used in Medical Research:
4-amino-2-Piperidinone is utilized in research for its potential applications in the treatment of various medical conditions, including neurological disorders and cancer. Its unique structure allows it to interact with biological targets, offering new avenues for therapeutic intervention.
Used in Material Science:
4-amino-2-Piperidinone is investigated for its potential role in the development of new materials and chemical processes. Its versatile chemical properties make it a candidate for creating innovative materials with specific characteristics for various industrial applications.
Overall, 4-amino-2-Piperidinone's diverse applications and potential for further research make it a compound of significant interest to the scientific community, particularly in the fields of chemistry, medicine, and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 5513-66-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,1 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5513-66:
(6*5)+(5*5)+(4*1)+(3*3)+(2*6)+(1*6)=86
86 % 10 = 6
So 5513-66-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O/c6-4-1-2-7-5(8)3-4/h4H,1-3,6H2,(H,7,8)
