55206-24-1 Usage
Uses
Used in Pharmaceutical Industry:
6-Fluorotryptamine hydrochloride is used as a reactant for the preparation of indole alkaloid drug candidates. Its application is primarily due to its ability to serve as a building block for the synthesis of various pharmaceutical compounds, including those with potential therapeutic applications in the treatment of neurological and psychiatric disorders.
As a reactant in the synthesis of indole alkaloid drug candidates, 6-Fluorotryptamine hydrochloride plays a significant role in the development of novel medications with improved efficacy, safety, and selectivity. The incorporation of a fluorine atom into the indole structure can lead to changes in the pharmacokinetic and pharmacodynamic properties of the resulting compounds, potentially enhancing their therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 55206-24-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,2,0 and 6 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 55206-24:
(7*5)+(6*5)+(5*2)+(4*0)+(3*6)+(2*2)+(1*4)=101
101 % 10 = 1
So 55206-24-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11FN2/c11-8-1-2-9-7(3-4-12)6-13-10(9)5-8/h1-2,5-6,13H,3-4,12H2/p+1
