55364-85-7 Usage
Uses
Used in Chemical Synthesis:
METHYL 3-(PYRIDIN-2-YLAMINO)PROPANOATE is used as a reagent in chemical synthesis for its ability to participate in a variety of reactions, contributing to the formation of new compounds with desired properties. Its unique characteristics make it a valuable component in the synthesis of complex organic molecules.
Used in Laboratory Research:
In the field of laboratory research, METHYL 3-(PYRIDIN-2-YLAMINO)PROPANOATE is utilized as a key component in experiments aimed at understanding and optimizing chemical reactions. Its reactivity allows researchers to explore new pathways and mechanisms in organic chemistry.
Used in Pharmaceutical Development:
Although not explicitly mentioned in the provided materials, given its reactivity and structural features, METHYL 3-(PYRIDIN-2-YLAMINO)PROPANOATE could potentially be used in the pharmaceutical industry as an intermediate in the synthesis of drug molecules, contributing to the development of new therapeutic agents.
Used in Material Science:
Similarly, while not specified, the compound's properties might also make it suitable for applications in material science, where it could be employed in the synthesis of novel materials with specific characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 55364-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,3,6 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55364-85:
(7*5)+(6*5)+(5*3)+(4*6)+(3*4)+(2*8)+(1*5)=137
137 % 10 = 7
So 55364-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c1-13-9(12)5-7-11-8-4-2-3-6-10-8/h2-4,6H,5,7H2,1H3,(H,10,11)
