55424-87-8 Usage
Chemical class
Thioureas
Structural feature
Contains a triazole ring
Common use
As a ligand in coordination chemistry
Building block
In the synthesis of various heterocyclic compounds
Pharmaceutical applications
Inhibits certain enzymes and has antimicrobial properties
Potential use
Treatment of cancer
Industrial applications
As a corrosion inhibitor
Ongoing research
Diverse applications in various fields
Check Digit Verification of cas no
The CAS Registry Mumber 55424-87-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,2 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 55424-87:
(7*5)+(6*5)+(5*4)+(4*2)+(3*4)+(2*8)+(1*7)=128
128 % 10 = 8
So 55424-87-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N5S/c1-2-3-7-6(12)10-5-8-4-9-11-5/h2,4H,1,3H2,(H3,7,8,9,10,11,12)
