55453-00-4 Usage
Description
P-AMIDINOPHENYL P-(6-AMIDINO-2-INDOLYL)PHENYL ETHER DIHYDROCHLORIDE, also known as Granular Blue, is a fluorescent neuronal tracer with a unique chemical structure. It is characterized by its ability to bind to specific cellular components, making it a valuable tool in various research applications.
Uses
Used in Neuroscience Research:
P-AMIDINOPHENYL P-(6-AMIDINO-2-INDOLYL)PHENYL ETHER DIHYDROCHLORIDE is used as a fluorescent neuronal tracer for visualizing and studying the structure and function of neurons. Its ability to selectively bind to specific cellular components allows researchers to gain insights into neuronal morphology, connectivity, and activity.
Used in Drug Screening and Development:
Due to its structural similarity to Granular Blue, P-AMIDINOPHENYL P-(6-AMIDINO-2-INDOLYL)PHENYL ETHER DIHYDROCHLORIDE can be used in drug screening and development processes. It may serve as a potential lead compound for the development of new drugs targeting specific cellular pathways or mechanisms.
Used in Diagnostic Applications:
P-AMIDINOPHENYL P-(6-AMIDINO-2-INDOLYL)PHENYL ETHER DIHYDROCHLORIDE can be employed in diagnostic applications, particularly in the detection and analysis of various cellular processes and conditions. Its fluorescent properties make it an ideal candidate for imaging techniques and assays.
Used in Biomedical Imaging:
In the field of biomedical imaging, P-AMIDINOPHENYL P-(6-AMIDINO-2-INDOLYL)PHENYL ETHER DIHYDROCHLORIDE can be utilized as a contrast agent or marker to enhance the visualization of specific cellular structures or processes. This can aid in the diagnosis and monitoring of various diseases and conditions.
Used in Chemical Synthesis:
P-AMIDINOPHENYL P-(6-AMIDINO-2-INDOLYL)PHENYL ETHER DIHYDROCHLORIDE can also be used as a starting material or intermediate in the synthesis of other related compounds with potential applications in various industries, such as pharmaceuticals, materials science, and diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 55453-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,5 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 55453-00:
(7*5)+(6*5)+(5*4)+(4*5)+(3*3)+(2*0)+(1*0)=114
114 % 10 = 4
So 55453-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H19N5O.ClH/c23-21(24)14-5-9-18(10-6-14)28-17-7-3-13(4-8-17)19-11-15-1-2-16(22(25)26)12-20(15)27-19;/h1-12,27H,(H3,23,24)(H3,25,26);1H