55462-54-9 Usage
Uses
Used in Pharmaceutical Industry:
5-(2,3-Dichlorophenyl)-2-furoic acid is utilized as a building block for the synthesis of various pharmaceuticals. Its specific chemical structure allows it to be a key component in the creation of drugs that target specific biological pathways or receptors, potentially leading to the development of new treatments for a range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 5-(2,3-Dichlorophenyl)-2-furoic acid serves as a crucial intermediate in the production of pesticides and other crop protection agents. Its chlorine-containing structure can contribute to the effectiveness of these compounds, enhancing their ability to protect crops from pests and diseases.
Used in Chemical Research:
5-(2,3-Dichlorophenyl)-2-furoic acid is also employed as an intermediate in the production of various chemical compounds for research purposes. Its unique structure makes it a valuable tool for chemists and researchers working on the development of new materials and applications within the chemical industry.
Overall, 5-(2,3-Dichlorophenyl)-2-furoic acid's versatility and unique structural features make it a valuable asset in multiple industries, particularly in the development and synthesis of pharmaceuticals, agrochemicals, and other chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 55462-54-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,6 and 2 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 55462-54:
(7*5)+(6*5)+(5*4)+(4*6)+(3*2)+(2*5)+(1*4)=129
129 % 10 = 9
So 55462-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H6Cl2O3/c12-7-3-1-2-6(10(7)13)8-4-5-9(16-8)11(14)15/h1-5H,(H,14,15)
