55476-36-3 Usage
Uses
Used in Pharmaceutical Industry:
5-(Diethylamino)uracil is used as a research compound for the development of potential anticancer agents, leveraging its capacity to inhibit the proliferation of cancer cells by interfering with nucleic acid synthesis.
Used in Antiviral Applications:
5-(Diethylamino)uracil is studied for its potential use in antiviral treatments, given its ability to disrupt the biosynthetic pathways necessary for viral replication.
Used in Antiparasitic Applications:
5-(Diethylamino)uracil is also being investigated for its potential role in antiparasitic therapies, where it could potentially inhibit the growth and reproduction of parasitic organisms by targeting their nucleic acid synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 55476-36-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,7 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55476-36:
(7*5)+(6*5)+(5*4)+(4*7)+(3*6)+(2*3)+(1*6)=143
143 % 10 = 3
So 55476-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N3O2/c1-3-11(4-2)6-5-9-8(13)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12,13)
