55525-35-4 Usage
Long-chain thiol
Contains a sulfur atom bonded to a carbon atom, giving the compound unique chemical properties and making it suitable for various applications.
Hydroxyl group
Presence of an -OH group in the molecule, contributing to its solubility and reactivity.
Metal nanoparticle modifier
1-mercaptohexadecan-2-ol can bind to metal surfaces, stabilizing the nanoparticles and preventing aggregation.
Antibacterial properties
The compound has been found to exhibit antibacterial activity, making it potentially useful in medical and cosmetic applications.
Antifungal properties
1-mercaptohexadecan-2-ol also demonstrates antifungal activity, further expanding its potential applications in various industries.
Lubricant
Due to its long carbon chain, the compound can be used as a lubricant, reducing friction between surfaces.
Surfactant
1-mercaptohexadecan-2-ol can act as a surfactant in the production of emulsions, helping to stabilize mixtures of immiscible liquids.
Versatile compound
1-mercaptohexadecan-2-ol's unique chemical properties make it suitable for a wide range of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 55525-35-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,5,2 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55525-35:
(7*5)+(6*5)+(5*5)+(4*2)+(3*5)+(2*3)+(1*5)=124
124 % 10 = 4
So 55525-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H34OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(17)15-18/h16-18H,2-15H2,1H3
