55621-49-3 Usage
Uses
Used in Organic Synthesis:
5,6-Diamino-1,3-dihydro-2H-benzoimidazol-2-one is used as a key compound in organic synthesis for its ability to contribute to the formation of complex molecular structures. Its presence in reactions can lead to the development of new and innovative materials with potential applications across various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5,6-Diamino-1,3-dihydro-2H-benzoimidazol-2-one is used as an intermediate in the synthesis of various drugs. Its unique chemical properties allow it to be a versatile building block for creating new medications with specific therapeutic properties.
Used in Chemical Research:
5,6-Diamino-1,3-dihydro-2H-benzoimidazol-2-one is also utilized in chemical research as a model compound for studying the properties and behavior of similar organic compounds. This helps researchers gain a deeper understanding of the underlying chemical principles and mechanisms involved in various reactions and processes.
Used in Material Science:
In the field of material science, 5,6-Diamino-1,3-dihydro-2H-benzoimidazol-2-one can be used as a component in the development of new materials with specific properties, such as enhanced stability, reactivity, or selectivity. Its incorporation into these materials can lead to improved performance and functionality.
Used in Environmental Applications:
5,6-Diamino-1,3-dihydro-2H-benzoimidazol-2-one may also find use in environmental applications, such as in the development of new methods for pollution control or waste management. Its unique chemical properties can be harnessed to create innovative solutions for addressing environmental challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 55621-49-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,6,2 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 55621-49:
(7*5)+(6*5)+(5*6)+(4*2)+(3*1)+(2*4)+(1*9)=123
123 % 10 = 3
So 55621-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4O/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,8-9H2,(H2,10,11,12)
