55651-36-0 Usage
Parent compound
Cyclopenta[a]phenanthrene derivative
Hydroxymethyl group
Located at the 11th carbon position
Ketone group
Located at the 17th carbon position
Steroidality
Steroid-like structure
Pharmacological potential
Possible biological activity due to structural similarity to other steroids
Applications
Potential use in pharmaceutical research and drug development
Therapeutic effects
May have potential therapeutic effects (requires further research)
Molecular weight
Approximately 310 g/mol (based on the chemical formula)
Structural complexity
Contains a fused ring system (cyclopenta[a]phenanthrene core) with additional functional groups
Research necessity
Further research needed to fully understand its properties and potential applications
Check Digit Verification of cas no
The CAS Registry Mumber 55651-36-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,6,5 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55651-36:
(7*5)+(6*5)+(5*6)+(4*5)+(3*1)+(2*3)+(1*6)=130
130 % 10 = 0
So 55651-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H14O2/c19-10-12-9-16-14(7-8-17(16)20)15-6-5-11-3-1-2-4-13(11)18(12)15/h1-6,9,19H,7-8,10H2
