55739-39-4 Usage
Uses
Used in Pharmaceutical Industry:
3-(Carboxymethylaminomethyl)-4-hydroxybenzoic acid is used as a pharmaceutical agent for its ability to inhibit the activity of the chorismate lyase enzyme. This inhibition can have therapeutic implications, particularly in the development of treatments targeting certain diseases where the enzyme plays a crucial role in their progression.
Used in Research Applications:
In the field of scientific research, 3-(Carboxymethylaminomethyl)-4-hydroxybenzoic acid is utilized as a research tool to study the function and regulation of the chorismate lyase enzyme. This can aid in understanding the enzyme's role in various biological pathways and contribute to the discovery of new therapeutic targets.
Used in Drug Development:
3-(Carboxymethylaminomethyl)-4-hydroxybenzoic acid can be employed in the development of new drugs that target the chorismate lyase enzyme. By incorporating this organic building block into drug molecules, researchers can potentially create more effective and specific treatments for diseases associated with the enzyme's activity.
Check Digit Verification of cas no
The CAS Registry Mumber 55739-39-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,7,3 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 55739-39:
(7*5)+(6*5)+(5*7)+(4*3)+(3*9)+(2*3)+(1*9)=154
154 % 10 = 4
So 55739-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO5/c12-8-2-1-6(10(15)16)3-7(8)4-11-5-9(13)14/h1-3,11-12H,4-5H2,(H,13,14)(H,15,16)
