557789-62-5 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Dibromo-3-fluoro-nitrobenzene is used as a precursor in the synthesis of various pharmaceuticals due to its reactivity and the ability to be further functionalized in chemical reactions. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Dye Industry:
2,4-Dibromo-3-fluoro-nitrobenzene is utilized in the manufacturing of dyes, where its reactive nature and structural features contribute to the creation of dyes with distinct color characteristics and properties, suitable for various applications.
Used in Agrochemical Industry:
2,4-Dibromo-3-fluoro-nitrobenzene is employed in the production of agrochemicals, serving as a key intermediate in the synthesis of pesticides and other agricultural chemicals, enhancing crop protection and yield.
Used in Specialty Chemicals Production:
As a building block, 2,4-Dibromo-3-fluoro-nitrobenzene is used in the creation of specialty chemicals, which are often tailored for specific industrial applications, such as in the development of high-performance materials.
Used in Research Reagents:
2,4-Dibromo-3-fluoro-nitrobenzene also serves as a research reagent, facilitating scientific investigations and the discovery of new chemical reactions and processes in the field of organic chemistry.
It is crucial to handle 2,4-Dibromo-3-fluoro-nitrobenzene with care due to its toxic nature and potential environmental impact, ensuring safe laboratory practices and proper disposal methods.
Check Digit Verification of cas no
The CAS Registry Mumber 557789-62-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,5,7,7,8 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 557789-62:
(8*5)+(7*5)+(6*7)+(5*7)+(4*8)+(3*9)+(2*6)+(1*2)=225
225 % 10 = 5
So 557789-62-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Br2FNO2/c7-3-1-2-4(10(11)12)5(8)6(3)9/h1-2H
