557792-56-0 Usage
General Description
5-Methyl-4-phenyl-thiophene-3-carboxylic acid is a chemical compound with a molecular formula C13H10O2S. It is a thiophene derivative with a phenyl and carboxylic acid group attached to the thiophene ring. 5-METHYL-4-PHENYL-THIOPHENE-3-CARBOXYLIC ACID has potential applications in the field of organic synthesis and materials science due to its unique structure and properties. Its synthesis and characterization are of interest to researchers for the development of new pharmaceuticals, agrochemicals, and agrochemical intermediates. Additionally, it may also have potential applications in the development of photoactive materials, liquid crystals, and organic electronic devices. Further study of this compound may lead to the discovery of new applications and uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 557792-56-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,5,7,7,9 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 557792-56:
(8*5)+(7*5)+(6*7)+(5*7)+(4*9)+(3*2)+(2*5)+(1*6)=210
210 % 10 = 0
So 557792-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O2S/c1-8-11(9-5-3-2-4-6-9)10(7-15-8)12(13)14/h2-7H,1H3,(H,13,14)