55786-36-2 Usage
General Description
The chemical compound "(1aR,10aβ,10bα)-2β-Isopropyl-5bα,8aβ-dimethyl-8bβ,9,10a,10b-tetrahydro-4H,6H-furo[2',3',4':4,5]oxireno[2,3]naphtho[2,1-c]pyran-4,9-dione" is a complex, organic compound that contains a fused ring system and several stereocenters. It is a type of naphthoquinone derivative, and its specific chemical structure includes isopropyl and dimethyl substituents on the rings. (1aR,10aβ,10bα)-2β-Isopropyl-5bα,8aβ-dimethyl-8bβ,9,10a,10b-tetrahydro-4H,6H-furo[2',3',4':4,5]oxireno[2,3]naphtho[2,1-c]pyran-4,9-dione is likely to have significant biological activity and potential medicinal uses due to its complex structure and the presence of functional groups such as furans and lactones. Due to its complex and unique structure, this compound may be of interest for further study in the fields of organic chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 55786-36-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,7,8 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55786-36:
(7*5)+(6*5)+(5*7)+(4*8)+(3*6)+(2*3)+(1*6)=162
162 % 10 = 2
So 55786-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H22O5/c1-9(2)14-19-10(8-11(20)22-14)17(3)6-5-7-18(4)13(17)12(15(19)24-19)23-16(18)21/h5,7-9,12-15H,6H2,1-4H3/t12-,13+,14+,15+,17+,18-,19+/m0/s1