55817-76-0 Usage
Properties
1. Chemical compound with a pyrrole ring structure
2. Contains an amino group, two dimethylamino groups, and a carbonitrile group
3. Used in organic synthesis and pharmaceutical research
4. Potential applications in medicinal chemistry
5. Valuable building block for the synthesis of organic compounds
Specific content
1. Name: 2-AMINO-1-[3-(DIMETHYLAMINO)PROPYL]-4,5-DIMETHYL-1H-PYRROLE-3-CARBONITRILE
2. Molecular structure: Contains a pyrrole ring with an amino group, two dimethylamino groups, and a carbonitrile group
3. Applications: Used in organic synthesis, pharmaceutical research, and potentially medicinal chemistry
4. Potential uses: Valuable building block for the synthesis of various organic compounds, but requires further research to fully understand potential properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 55817-76-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,8,1 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55817-76:
(7*5)+(6*5)+(5*8)+(4*1)+(3*7)+(2*7)+(1*6)=150
150 % 10 = 0
So 55817-76-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H20N4/c1-9-10(2)16(7-5-6-15(3)4)12(14)11(9)8-13/h5-7,14H2,1-4H3
