55836-69-6 Usage
Uses
Used in Organic Synthesis:
3-Ethoxybenzamide is employed as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of different chemical entities, making it a valuable building block in the creation of complex molecules.
Used in Pharmaceutical Drugs:
3-Ethoxybenzamide is used as a starting material or a component in the development of pharmaceutical drugs. Its presence in drug molecules can contribute to the desired therapeutic effects, and its properties can be manipulated to improve drug efficacy and safety.
Used in Research and Development:
In the field of research and development, 3-ethoxybenzamide serves as a model compound for studying the properties and reactivity of benzamides. This knowledge can be applied to the design and synthesis of new compounds with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 55836-69-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,8,3 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 55836-69:
(7*5)+(6*5)+(5*8)+(4*3)+(3*6)+(2*6)+(1*9)=156
156 % 10 = 6
So 55836-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11)
