55879-73-7 Usage
Derivative of methacrylic acid and xylyl compounds
2,6-xylyl methacrylate is a chemical compound that is derived from methacrylic acid and xylyl compounds, which gives it unique properties.
Commonly used in polymer and resin production
This chemical is commonly used in the production of various polymers and resins, which are essential for a wide range of applications.
Used in coatings, adhesives, and sealants
2,6-xylyl methacrylate is used in the production of coatings, adhesives, and sealants, and is known for its good adhesion properties, high hardness, and resistance to chemicals and UV radiation.
Valuable ingredient in durable coatings
Due to its properties, 2,6-xylyl methacrylate is a valuable ingredient in the formulation of durable and long-lasting coatings.
Potential use in biomedical applications
2,6-xylyl methacrylate has been studied for its potential use in biomedical applications, such as tissue engineering and drug delivery systems, due to its biocompatibility and ability to be modified to achieve specific material properties.
Significant role in high-performance materials
This chemical plays a significant role in the production of high-performance materials and has potential for various advanced applications.
Check Digit Verification of cas no
The CAS Registry Mumber 55879-73-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,8,7 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 55879-73:
(7*5)+(6*5)+(5*8)+(4*7)+(3*9)+(2*7)+(1*3)=177
177 % 10 = 7
So 55879-73-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O2/c1-8(2)12(13)14-11-9(3)6-5-7-10(11)4/h5-7H,1H2,2-4H3
