55898-15-2 Usage
Description
DEHYDRONANTENINE is an alkaloid derived from the tree bark of Nandina domestica, which forms colorless crystals when dissolved in ethanol (EtOH). Its structure has been confirmed through ultraviolet and NMR spectroscopy, with the application of the nuclear Overhauser effect providing additional insights. The synthesis of this alkaloid is achieved through the dehydrogenation of O-methyldomesticine.
Uses
1. Used in Pharmaceutical Industry:
DEHYDRONANTENINE is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: DEHYDRONANTENINE is used as a pharmaceutical compound for its potential therapeutic applications.
2. Used in Chemical Synthesis:
DEHYDRONANTENINE serves as a key intermediate in the synthesis of other alkaloids and organic compounds. The expression is: DEHYDRONANTENINE is used as a key intermediate in the synthesis of other alkaloids and organic compounds.
3. Used in Research and Development:
This alkaloid is utilized in research and development for studying its chemical properties, structural characteristics, and potential applications in various fields. The expression is: DEHYDRONANTENINE is used as a research compound for studying its chemical properties, structural characteristics, and potential applications in various fields.
4. Used in Analytical Chemistry:
DEHYDRONANTENINE can be employed in analytical chemistry for the development of new methods and techniques in the identification and quantification of alkaloids. The expression is: DEHYDRONANTENINE is used as a reference compound in analytical chemistry for the development of new methods and techniques in the identification and quantification of alkaloids.
References
Kunimoto et al., Yakugaku Zasshi, 94, 1149 (1974)
Kunirnoto et al., ibid, 95, 445 (1975)
Check Digit Verification of cas no
The CAS Registry Mumber 55898-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,8,9 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55898-15:
(7*5)+(6*5)+(5*8)+(4*9)+(3*8)+(2*1)+(1*5)=172
172 % 10 = 2
So 55898-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H19NO4/c1-21-5-4-11-7-17(22-2)20(23-3)19-13-9-16-15(24-10-25-16)8-12(13)6-14(21)18(11)19/h6-9H,4-5,10H2,1-3H3