55911-96-1 Usage
Description
1,3,6-triaminohexane, also known as hexamethylenediamine, is a colorless liquid chemical compound with the formula C6H16N3. It has a strong ammonia-like odor and is known for its versatile applications across various industries due to its unique chemical properties.
Uses
Used in Nylon Production:
1,3,6-triaminohexane is used as a key ingredient in the production of nylon, a synthetic polymer known for its strength, durability, and resistance to various environmental conditions. It contributes to the formation of the polymer chain, providing the necessary amide linkages.
Used as a Curing Agent for Epoxy Resins:
In the manufacturing of epoxy resins, 1,3,6-triaminohexane serves as an effective curing agent. It reacts with the epoxy groups to form a three-dimensional network, resulting in a hard, thermosetting polymer with excellent mechanical and chemical resistance properties.
Used in Pharmaceutical Synthesis:
1,3,6-triaminohexane is utilized as an intermediate in the synthesis of various pharmaceuticals. Its amine groups can be used to form amide, urea, or other functional groups, making it a valuable building block for the development of new drugs.
Used in Agricultural Chemicals:
1,3,6-triaminohexane is also employed in the synthesis of agricultural chemicals, such as herbicides, insecticides, and fungicides. Its reactivity and ability to form various functional groups make it suitable for creating active ingredients in these products.
Used in Adhesives, Coatings, and Plastics Production:
1,3,6-triaminohexane finds applications in the production of adhesives, coatings, and plastics due to its ability to form strong cross-linked structures. It enhances the adhesive properties, durability, and resistance to environmental factors in these materials.
Safety Precautions:
While 1,3,6-triaminohexane is a versatile compound, it should be handled with care. It can cause irritation to the skin and respiratory system if not properly managed. Adequate safety measures, such as wearing protective gear and ensuring proper ventilation, should be taken during its use and handling.
Check Digit Verification of cas no
The CAS Registry Mumber 55911-96-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,9,1 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55911-96:
(7*5)+(6*5)+(5*9)+(4*1)+(3*1)+(2*9)+(1*6)=141
141 % 10 = 1
So 55911-96-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H17N3/c7-4-1-2-6(9)3-5-8/h6H,1-5,7-9H2