55915-30-5 Usage
Explanation
Different sources of media describe the Explanation of 55915-30-5 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. The compound consists of a 1H-1,2,4-triazolium ring, which is a five-membered ring with three nitrogen atoms and two hydrogen atoms, and a phenylamino group, which is a phenyl group (a six-carbon ring with a hydrogen atom) attached to an amino group (a nitrogen atom with two hydrogen atoms).
3. Bromide salt derivative
3. The compound is used as a building block for the preparation of various heterocyclic compounds and pharmaceuticals, which are important in the development of new drugs and materials.
4. The compound has been studied for its potential to exhibit antimicrobial (fighting against microorganisms), anticancer (inhibiting the growth of cancer cells), and antiviral (inhibiting the replication of viruses) properties.
5. The bromide salt form of the compound allows for easier handling and storage compared to the free base form, making it more convenient for researchers and chemists to work with in the laboratory.
Structure
1H-1,2,4-Triazolium ring and a phenylamino group
Application
Organic synthesis and medicinal chemistry
Biological activities
Antimicrobial, anticancer, and antiviral properties
Easier handling and storage
Bromide salt form
Check Digit Verification of cas no
The CAS Registry Mumber 55915-30-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,9,1 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 55915-30:
(7*5)+(6*5)+(5*9)+(4*1)+(3*5)+(2*3)+(1*0)=135
135 % 10 = 5
So 55915-30-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H18N4.BrH/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18;/h1-15H,16H2,(H,21,22);1H