56009-20-2 Usage
Uses
Used in Pharmaceutical Industry:
2-methyl-6-[4-(4-methylpentyl)cyclohexyl]heptane is used as a starting material in the synthesis of various organic compounds for pharmaceutical applications. Its unique structure and functional groups contribute to the development of new drugs and medicinal compounds.
Used in Agricultural Industry:
In the agricultural sector, 2-methyl-6-[4-(4-methylpentyl)cyclohexyl]heptane is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its complex structure allows for the creation of effective and targeted agricultural products.
Used in Materials Science:
2-methyl-6-[4-(4-methylpentyl)cyclohexyl]heptane is utilized in materials science as a component in the development of advanced materials, such as polymers and composites. Its unique properties can enhance the performance and characteristics of these materials.
Used as a Solvent:
Due to its chemical properties, 2-methyl-6-[4-(4-methylpentyl)cyclohexyl]heptane can also be used as a solvent in various industrial processes. Its ability to dissolve a wide range of substances makes it a valuable component in the production of different products.
Used in Research Applications:
In research settings, 2-methyl-6-[4-(4-methylpentyl)cyclohexyl]heptane serves as a valuable compound for studying chemical reactions and exploring new synthetic pathways. Its complex structure and functional groups provide opportunities for scientific discovery and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 56009-20-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,0,0 and 9 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 56009-20:
(7*5)+(6*6)+(5*0)+(4*0)+(3*9)+(2*2)+(1*0)=102
102 % 10 = 2
So 56009-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H40/c1-16(2)8-6-10-18(5)20-14-12-19(13-15-20)11-7-9-17(3)4/h16-20H,6-15H2,1-5H3
