56015-31-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-4,7-diazaindole is used as a building block for the development of new drugs and medicines due to its unique chemical properties and structure. It serves as a valuable component in the synthesis of more complex molecules, contributing to the advancement of pharmaceutical research and drug discovery.
Used in Organic Synthesis:
3-Bromo-4,7-diazaindole is used as a building block in organic synthesis for the creation of more complex molecules. Its presence in scientific literature and potential for further study highlight its significance in the field of chemistry, where it can be utilized to develop novel compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 56015-31-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,0,1 and 5 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 56015-31:
(7*5)+(6*6)+(5*0)+(4*1)+(3*5)+(2*3)+(1*1)=97
97 % 10 = 7
So 56015-31-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrN3/c7-4-3-10-6-5(4)8-1-2-9-6/h1-3H,(H,9,10)
