56095-73-9 Usage
Uses
Used in Stereoselective Polymerization:
(Z)-diisobutyl(4-methylpent-1-enyl)aluminium is used as a catalyst for stereoselective polymerization to control the polymer's stereochemistry and improve its properties. This is important for producing polymers with specific structural features that can be tailored for various applications.
Used in Organic Synthesis:
(Z)-diisobutyl(4-methylpent-1-enyl)aluminium is used as a reagent in organic synthesis for promoting various types of reactions, such as carbometalation, hydrometallation, and addition to carbonyl compounds. Its versatility allows for the creation of a wide range of complex organic molecules, which can be used in the development of new materials and pharmaceuticals.
Used in Catalysis:
(Z)-diisobutyl(4-methylpent-1-enyl)aluminium is used as a catalyst in various chemical reactions to increase the reaction rate and improve the yield of desired products. Its high reactivity and ability to participate in multiple types of reactions make it a valuable asset in the field of catalysis.
Used in Pharmaceutical Development:
(Z)-diisobutyl(4-methylpent-1-enyl)aluminium is used as a key intermediate in the synthesis of certain pharmaceutical compounds. Its unique reactivity allows for the creation of complex molecular structures that can be used as potential drug candidates.
Used in Material Science:
(Z)-diisobutyl(4-methylpent-1-enyl)aluminium is used in the development of new materials with specific properties, such as improved strength, durability, or chemical resistance. Its role in organic synthesis and catalysis enables the creation of novel materials with tailored characteristics for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 56095-73-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,0,9 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56095-73:
(7*5)+(6*6)+(5*0)+(4*9)+(3*5)+(2*7)+(1*3)=139
139 % 10 = 9
So 56095-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H11.2C4H9.Al/c1-4-5-6(2)3;2*1-4(2)3;/h1,4,6H,5H2,2-3H3;2*4H,1H2,2-3H3;/rC14H29Al/c1-12(2)8-7-9-15(10-13(3)4)11-14(5)6/h7,9,12-14H,8,10-11H2,1-6H3/b9-7-
