562856-84-2 Usage
Pyrimidine derivative
Contains a pyrimidine ring
Pyrimidine is a heterocyclic organic compound with two nitrogen atoms in a six-membered ring, which is a common structural motif in many biologically active molecules.
Pyridinium bromide moiety
Contains a positively charged pyridinium group
Pyridinium is a heterocyclic compound with a nitrogen atom in a six-membered ring, similar to pyrimidine, but with a positive charge on the nitrogen.
Salt
Consists of pyridinium cations and bromide anions
The compound is an ionic compound, formed by the electrostatic attraction between the positively charged pyridinium group and negatively charged bromide ions.
Pharmaceutical research and development
Used in the synthesis of various drugs
The compound's unique structure and properties make it a valuable building block for the development of new pharmaceuticals.
Organic synthesis
Employed as a starting material for the synthesis of other organic compounds
Due to its versatile structure, the compound can be used as a precursor in the synthesis of a wide range of organic molecules.
Potential applications
Treatment of various diseases and conditions
The compound's unique properties and reactivity make it a promising candidate for the development of new therapeutic agents.
Solubility
May vary depending on the solvent used
The solubility of the compound can influence its reactivity and its ability to be used in various chemical reactions.
Stability
May be sensitive to certain conditions, such as light, heat, or moisture
The compound's stability can affect its shelf life and its suitability for use in specific applications.
Purity
Can be an important factor in its effectiveness and safety
The purity of the compound is crucial for its intended use, as impurities can affect its reactivity and potential side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 562856-84-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,6,2,8,5 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 562856-84:
(8*5)+(7*6)+(6*2)+(5*8)+(4*5)+(3*6)+(2*8)+(1*4)=192
192 % 10 = 2
So 562856-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N5.2BrH/c11-9-8(6-13-10(12)14-9)7-15-4-2-1-3-5-15;;/h1-6H,7H2,(H4,11,12,13,14);2*1H/q+1;;/p-1
562856-84-2Relevant academic research and scientific papers
Wyss, Pierre C.,Gerber, Paul,Hartman, Peter G.,Hubschwerlen, Christian,Locher, Hans,Marty, Hans-Peter,Stahl, Martin
, p. 2304 - 2312 (2003)
Novel 2,4-diaminopyrimidines bearing N,N-disubstituted aminomethyl residues at the 5-position were designed as dihydrofolate reductase (DHFR) inhibitors. These compounds were obtained by treatment of 1-[(2,4-diamino-5-pyrimidinyl)methyl]pyridinium bromide
