56375-85-0 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-3,5-dihydroxy-N-methylbenzamide is used as a potential intermediate in the synthesis of other complex organic compounds for pharmaceutical applications. Its unique structure and functional groups may contribute to the development of new drugs or drug candidates.
Used in Chemical Research:
4-Bromo-3,5-dihydroxy-N-methylbenzamide is used as a subject of study in chemical research to understand its reactivity, toxicity, and potential applications. This can help in the development of safer and more effective handling procedures and uses for 4-Bromo-3,5-dihydroxy-N-methylbenzamide.
Used in Material Science:
4-Bromo-3,5-dihydroxy-N-methylbenzamide may be used in material science applications, where its unique properties could be exploited in the development of new materials or the improvement of existing ones. The presence of multiple functional groups may allow for various interactions with other compounds or materials.
Check Digit Verification of cas no
The CAS Registry Mumber 56375-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,3,7 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 56375-85:
(7*5)+(6*6)+(5*3)+(4*7)+(3*5)+(2*8)+(1*5)=150
150 % 10 = 0
So 56375-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrNO3/c1-10-8(13)4-2-5(11)7(9)6(12)3-4/h2-3,11-12H,1H3,(H,10,13)
