56409-57-5 Usage
Uses
Used in Pharmaceutical Industry:
5-Benzylthio-3-hydroxy-1,2,4-thiadiazole is used as a pharmaceutical candidate for its potential antifungal and antibacterial properties. It is being studied for the development of drugs that can combat various infections caused by fungi and bacteria.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Benzylthio-3-hydroxy-1,2,4-thiadiazole is used as an active ingredient in the development of pesticides and fungicides. Its antifungal and antibacterial properties make it a promising candidate for protecting crops from diseases and pests.
Used in Materials Science:
5-Benzylthio-3-hydroxy-1,2,4-thiadiazole is used in materials science for the development of corrosion inhibitors and functional materials. Its unique chemical structure allows it to be a potential component in creating advanced materials with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 56409-57-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,4,0 and 9 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 56409-57:
(7*5)+(6*6)+(5*4)+(4*0)+(3*9)+(2*5)+(1*7)=135
135 % 10 = 5
So 56409-57-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2OS2/c12-8-10-9(14-11-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)
