56433-13-7 Usage
Uses
Used in Pharmaceutical Development:
3-Amino-7-chloro-3,4-dihydro-1H-quinolin-2-one is used as a precursor in the synthesis of new pharmaceuticals for its antimicrobial and antifungal properties. It serves as a key component in the development of novel antibacterial and antiviral agents, contributing to the fight against drug-resistant infections.
Used in Material Science:
In the field of material science, 3-Amino-7-chloro-3,4-dihydro-1H-quinolin-2-one is utilized as a building block for the creation of new materials with unique properties. Its chemical structure allows for the engineering of materials with specific characteristics, such as enhanced stability or reactivity, for various applications.
Used in Antimicrobial Applications:
3-Amino-7-chloro-3,4-dihydro-1H-quinolin-2-one is employed as an antimicrobial agent, particularly effective against a range of bacteria and fungi. Its activity is attributed to its ability to disrupt essential cellular processes in microorganisms, thereby inhibiting their growth and proliferation.
Used in Antifungal Applications:
3-Amino-7-chloro-3,4-dihydro-1H-quinolin-2-one is also used as an antifungal agent, targeting various fungal species and preventing their growth. Its application in antifungal formulations can help in controlling fungal infections and maintaining the integrity of materials susceptible to fungal degradation.
Used in Research and Development:
3-Amino-7-chloro-3,4-dihydro-1H-quinolin-2-one serves as a subject of research for its potential applications in various industries. Its unique chemical properties make it an interesting candidate for further exploration and development, with the aim of discovering new uses and enhancing existing ones.
Check Digit Verification of cas no
The CAS Registry Mumber 56433-13-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,4,3 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56433-13:
(7*5)+(6*6)+(5*4)+(4*3)+(3*3)+(2*1)+(1*3)=117
117 % 10 = 7
So 56433-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClN2O/c10-6-2-1-5-3-7(11)9(13)12-8(5)4-6/h1-2,4,7H,3,11H2,(H,12,13)
56433-13-7Relevant academic research and scientific papers
PYRROLOPYRIDINE-2-CARBOXYLIC ACID AMIDES
-
Page/Page column 26, (2008/06/13)
Compounds represented by Formula (I) or pharmaceutically acceptable salts thereof, are useful in the prophylactic or therapeutic treatment of diabetes, hyperglycemia, hypercholesterolemia, hyperinsulinemia, hyperlipidemia, hypertension, atherosclerosis or tissue ischemia e.g. myocardial ischemia, and as cardioprotectants.
