56433-30-8 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
(1,2,4)Triazolo(1,5-a)pyrimidin-7(1H)-one, 2-(chloromethyl)-5-methylis used as a chemical intermediate for the synthesis of new compounds with potential biological activities. Its unique structure allows it to be a promising candidate for the development of antiviral, antimicrobial, or anticancer agents.
Further research and experimentation are necessary to fully explore the potential uses and effects of (1,2,4)Triazolo(1,5-a)pyrimidin-7(1H)-one, 2-(chloromethyl)-5-methyl- in various applications. Its role as a building block in the synthesis of new biologically active compounds could lead to advancements in the treatment of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 56433-30-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,4,3 and 3 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 56433-30:
(7*5)+(6*6)+(5*4)+(4*3)+(3*3)+(2*3)+(1*0)=118
118 % 10 = 8
So 56433-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN4O/c1-4-2-6(13)12-7(9-4)10-5(3-8)11-12/h2H,3H2,1H3,(H,9,10,11)
