56492-83-2 Usage
Uses
Used in Corrosion Inhibition:
5-BUTYLTHIO-1,3,4-THIADIAZOLE-2-THIOL is used as a corrosion inhibitor in various industrial applications. Its ability to form a protective film on metal surfaces makes it effective in preventing the corrosion process, thereby extending the life and functionality of metal components.
Used in Rubber Industry:
In the rubber industry, 5-BUTYLTHIO-1,3,4-THIADIAZOLE-2-THIOL is utilized as a vulcanization accelerator. It enhances the process of vulcanization, which is essential for improving the strength, elasticity, and durability of rubber products.
Used in Pharmaceutical and Agrochemical Synthesis:
5-BUTYLTHIO-1,3,4-THIADIAZOLE-2-THIOL serves as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical properties make it a valuable component in the development of new drugs and agricultural chemicals.
Used in Organic Electronics:
5-BUTYLTHIO-1,3,4-THIADIAZOLE-2-THIOL has potential applications in the field of organic electronics. Its properties may contribute to the development of new electronic devices and materials with improved performance and efficiency.
Used in Photopolymerization Processes:
As a photoinitiator, 5-BUTYLTHIO-1,3,4-THIADIAZOLE-2-THIOL plays a crucial role in photopolymerization processes. It helps initiate the polymerization reaction when exposed to light, enabling the creation of polymers with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 56492-83-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,4,9 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56492-83:
(7*5)+(6*6)+(5*4)+(4*9)+(3*2)+(2*8)+(1*3)=152
152 % 10 = 2
So 56492-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2S3/c1-2-3-4-10-6-8-7-5(9)11-6/h2-4H2,1H3,(H,7,9)
