56501-17-8 Usage
Uses
Used in Scientific Research:
6-Morpholinonicotinamide is used as a research compound for exploring its biological activity and potential therapeutic applications. Its unique chemical structure, featuring a morpholine ring, allows scientists to investigate its interactions with other chemicals and its effects on various biological systems.
Used in Medicinal Research:
6-Morpholinonicotinamide is employed as a medicinal research compound to study its potential as a therapeutic agent. 6-MorpholinonicotinaMide's basic and ether-like properties may contribute to its efficacy in treating certain medical conditions, although more research is needed to determine its specific applications and safety profile.
Used in Drug Development:
6-Morpholinonicotinamide is utilized as a starting material or intermediate in the development of new drugs. Its chemical properties and potential biological activity make it a promising candidate for further investigation in the pharmaceutical industry, with the aim of discovering novel therapeutic agents.
Used in Chemical Synthesis:
6-Morpholinonicotinamide is used as a building block or reagent in the synthesis of more complex chemical compounds. Its unique structure and properties may enable the creation of new molecules with specific functions or applications in various fields, such as materials science or nanotechnology.
Used in Analytical Chemistry:
6-Morpholinonicotinamide is employed as an analytical reagent or standard in various analytical techniques, such as chromatography or spectroscopy. Its distinct chemical properties can be used to identify, quantify, or characterize other compounds in complex mixtures or samples.
Check Digit Verification of cas no
The CAS Registry Mumber 56501-17-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,5,0 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 56501-17:
(7*5)+(6*6)+(5*5)+(4*0)+(3*1)+(2*1)+(1*7)=108
108 % 10 = 8
So 56501-17-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3O2/c11-10(14)8-1-2-9(12-7-8)13-3-5-15-6-4-13/h1-2,7H,3-6H2,(H2,11,14)
