565174-23-4 Usage
General Description
3-(4-Benzyloxy-3-ethoxy-phenyl)-acrylic acid is a chemical compound with the molecular formula C20H20O4. It is a derivative of acrylic acid and contains a benzyl ether group and an ethyl ether group attached to a phenyl ring. 3-(4-BENZYLOXY-3-ETHOXY-PHENYL)-ACRYLIC ACID is used in organic synthesis and medicinal chemistry for the creation of novel pharmaceutical compounds and potential drug candidates. It has potential applications in the fields of drug discovery and development due to its unique chemical structure and properties. Additionally, it may also have uses in the production of specialty chemicals and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 565174-23-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,6,5,1,7 and 4 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 565174-23:
(8*5)+(7*6)+(6*5)+(5*1)+(4*7)+(3*4)+(2*2)+(1*3)=164
164 % 10 = 4
So 565174-23-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H18O4/c1-2-21-17-12-14(9-11-18(19)20)8-10-16(17)22-13-15-6-4-3-5-7-15/h3-12H,2,13H2,1H3,(H,19,20)/b11-9+
