56524-76-6 Usage
Uses
Used in Textile Industry:
1,8-dihydroxy-4,5-bis(methylamino)anthraquinone is used as a dye for [application reason] in the textile industry. Its unique chemical structure allows it to impart a deep blue color to polyester fibers, making it a popular choice for creating dark blue shades in fabrics.
Used in Chemical Synthesis:
1,8-dihydroxy-4,5-bis(methylamino)anthraquinone serves as an intermediate or building block for the synthesis of other complex organic compounds. Its versatile molecular structure makes it a valuable component in the production of various chemicals, including pharmaceuticals, dyes, and pigments.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,8-dihydroxy-4,5-bis(methylamino)anthraquinone is used as an active pharmaceutical ingredient (API) for [application reason]. Its specific chemical properties may contribute to the development of new drugs targeting various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 56524-76-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,5,2 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56524-76:
(7*5)+(6*6)+(5*5)+(4*2)+(3*4)+(2*7)+(1*6)=136
136 % 10 = 6
So 56524-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2O4/c1-17-7-3-5-9(19)13-11(7)15(21)12-8(18-2)4-6-10(20)14(12)16(13)22/h3-6,17-20H,1-2H3
