56595-12-1 Usage
Structure
Fluorinated derivative of naphthyridine, a bicyclic compound containing a pyridine ring fused to a benzene ring.
Application
Used in organic synthesis and pharmaceutical research as a building block for the synthesis of various bioactive compounds and pharmaceutical drugs.
Unique property
Its fluorinated structure gives it specific properties that make it valuable in medicinal chemistry and drug discovery.
Stability
The hexafluorination of the naphthyridine ring can lead to increased stability of the resulting drug candidates.
Pharmacokinetics
The hexafluorination of the naphthyridine ring can improve the pharmacokinetics of the resulting drug candidates.
Reactivity
Due to its fluorinated structure, it may have different reactivity compared to non-fluorinated naphthyridine derivatives.
Solubility
The solubility of 1,8-Naphthyridine,2,3,4,5,6,7-hexafluoro- may be affected by the presence of fluorine atoms in its structure.
Purity
As a building block for pharmaceutical synthesis, high purity is essential for its use in drug discovery and development.
Safety
Proper handling and storage are required due to its potential reactivity and the presence of fluorine atoms.
Check Digit Verification of cas no
The CAS Registry Mumber 56595-12-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,5,9 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 56595-12:
(7*5)+(6*6)+(5*5)+(4*9)+(3*5)+(2*1)+(1*2)=151
151 % 10 = 1
So 56595-12-1 is a valid CAS Registry Number.
InChI:InChI=1/C8F6N2/c9-2-1-3(10)5(12)7(14)16-8(1)15-6(13)4(2)11
