56600-56-7 Usage
General Description
1,6-diamino-7H-benz[de]anthracen-7-one is a chemical compound with the molecular formula C18H14N2O. It is a derivative of the anthracene group and contains two amino groups and a carbonyl group. 1,6-diamino-7H-benz[de]anthracen-7-one is a known aromatic amine and has potential applications in the field of organic synthesis and materials science. Its specific chemical properties and reactivity make it a valuable precursor for the synthesis of various organic compounds and polymers. Additionally, its aromatic structure could also make it a potential candidate for use in the development of organic electronic materials and dyes.
Check Digit Verification of cas no
The CAS Registry Mumber 56600-56-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,0 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56600-56:
(7*5)+(6*6)+(5*6)+(4*0)+(3*0)+(2*5)+(1*6)=117
117 % 10 = 7
So 56600-56-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H12N2O/c18-12-7-5-9-6-8-13(19)16-14(9)15(12)10-3-1-2-4-11(10)17(16)20/h1-8H,18-19H2