56616-91-2 Usage
Uses
Used in Chemical Synthesis:
3-bromo-1-methyl-1,2,4-triazole is used as a valuable intermediate in the synthesis of substituted triazoles. Its unique structure allows for a range of chemical reactions, making it a popular choice for the development of new compounds with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-bromo-1-methyl-1,2,4-triazole is used as a building block for the development of new drugs. Its chemical properties enable the creation of novel molecules with potential therapeutic effects, contributing to the advancement of medical treatments.
Used in Agrochemical Industry:
3-bromo-1-methyl-1,2,4-triazole also finds application in the agrochemical industry, where it is used as a starting material for the synthesis of various agrochemicals. These synthesized compounds can be used as pesticides, herbicides, or fungicides, helping to protect crops and improve agricultural productivity.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 3-bromo-1-methyl-1,2,4-triazole is utilized as a key intermediate for the production of various dyes and pigments. Its unique chemical structure allows for the creation of a wide range of colors, making it an essential component in the development of new dyes and pigments for various applications, such as textiles, plastics, and printing inks.
Used in Material Science:
3-bromo-1-methyl-1,2,4-triazole is also employed in material science, where it is used as a component in the development of new materials with specific properties. These materials can be used in various applications, such as electronics, coatings, and adhesives, where their unique properties can provide advantages over traditional materials.
Check Digit Verification of cas no
The CAS Registry Mumber 56616-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,1 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 56616-91:
(7*5)+(6*6)+(5*6)+(4*1)+(3*6)+(2*9)+(1*1)=142
142 % 10 = 2
So 56616-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H4BrN3/c1-7-2-5-3(4)6-7/h2H,1H3