56682-66-7 Usage
General Description
2-OXO-1,2-DIHYDRO-3-QUINOLINECARBALDEHYDE OXIME is a chemical compound, more commonly known by its shorter name, Oxime. Oximes are chemical compounds that possess a functional group with the general formula RR'NOH where R and R’ can be either aliphatic or aromatic. They are essentially derived from condensation reactions between aldehydes or ketones and hydroxylamine. They are typically solid substances with melting points higher than room temperature, and they are known for their applicability in organic chemistry as they can be employed in certain specific transformations, such as the Beckmann rearrangement. They are also used in the production of certain pharmaceuticals and pesticides. However, they must be handled with caution due to their potential hazards, as some oximes can be toxic or carcinogenic.
Check Digit Verification of cas no
The CAS Registry Mumber 56682-66-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,8 and 2 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56682-66:
(7*5)+(6*6)+(5*6)+(4*8)+(3*2)+(2*6)+(1*6)=157
157 % 10 = 7
So 56682-66-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O2/c13-10-8(6-11-14)5-7-3-1-2-4-9(7)12-10/h1-6,14H,(H,12,13)/b11-6+