567-63-5 Usage
Uses
Used in Dye Production:
3-Fluoro-2-nitroaniline is used as a chemical intermediate in the production of dyes. Its unique chemical structure allows for the creation of a variety of colored compounds, making it valuable in the dye industry for developing new and improved dyes.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 3-fluoro-2-nitroaniline serves as a key intermediate for the synthesis of various drugs. Its presence in the molecular structure can influence the drug's properties, such as solubility, stability, and biological activity, contributing to the development of new medications.
Used in Agricultural Chemicals:
3-Fluoro-2-nitroaniline is also utilized in the production of agricultural chemicals, such as pesticides and herbicides. Its chemical properties make it a useful component in the formulation of these products, potentially enhancing their effectiveness in controlling pests and weeds.
Check Digit Verification of cas no
The CAS Registry Mumber 567-63-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,6 and 7 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 567-63:
(5*5)+(4*6)+(3*7)+(2*6)+(1*3)=85
85 % 10 = 5
So 567-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5FN2O2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H,8H2
