56711-06-9 Usage
Uses
Used in Organic Synthesis and Peptide Chemistry:
AC-ILE-NH2 is used as a building block for constructing more complex molecules, facilitating the development of novel compounds with potential applications in various fields.
Used in Research:
AC-ILE-NH2 is used as a model compound for studying the behavior of similar peptides, providing insights into their properties and interactions, which can be crucial for understanding biological processes and developing new therapeutic agents.
Used in Analytical Chemistry:
AC-ILE-NH2 is used as a reference standard, ensuring the accuracy and reliability of analytical methods and measurements in various chemical and biological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 56711-06-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,7,1 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56711-06:
(7*5)+(6*6)+(5*7)+(4*1)+(3*1)+(2*0)+(1*6)=119
119 % 10 = 9
So 56711-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2O2/c1-4-5(2)7(8(9)12)10-6(3)11/h5,7H,4H2,1-3H3,(H2,9,12)(H,10,11)/t5-,7-/m0/s1
