56737-75-8 Usage
Uses
Used in Scientific Research:
2,3-Dimethylphenylhydrazine hydrochloride is used as a chemical intermediate for the synthesis of various organic compounds and pharmaceuticals. Its unique structure allows it to participate in a range of chemical reactions, making it a valuable asset in the development of new molecules and materials.
Used in Chemical Experiments:
In the field of chemistry, 2,3-dimethylphenylhydrazine hydrochloride is employed as a reagent in various experimental procedures. Its ability to form complexes and participate in redox reactions makes it a useful tool for studying chemical properties and mechanisms.
Used in Manufacturing Processes:
2,3-Dimethylphenylhydrazine hydrochloride is utilized as a key component in the production of certain specialty chemicals and materials. Its presence in the manufacturing process can influence the final product's properties, such as stability, reactivity, or performance.
Check Digit Verification of cas no
The CAS Registry Mumber 56737-75-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,7,3 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 56737-75:
(7*5)+(6*6)+(5*7)+(4*3)+(3*7)+(2*7)+(1*5)=158
158 % 10 = 8
So 56737-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2.ClH.H2O/c1-6-4-3-5-8(10-9)7(6)2;;/h3-5,10H,9H2,1-2H3;1H;1H2
