5679-18-5 Usage
Uses
Given the current state of scientific research, the specific applications of ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate are not extensively documented. However, based on its chemical structure and the properties of similar compounds, we can hypothesize several potential uses across various industries:
Used in Pharmaceutical Industry:
Ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate could be utilized as an intermediate in the synthesis of pharmaceuticals for its potential medicinal properties, such as anti-inflammatory, analgesic, or antimicrobial activities, due to the presence of the nitro and methyl groups which can influence its reactivity and interaction with biological systems.
Used in Chemical Synthesis:
In the field of organic chemistry, ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate might serve as a building block or reactant in the synthesis of more complex organic molecules, leveraging its functional groups to form new compounds with diverse applications.
Used in Material Science:
ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate could be explored for its potential in material science, possibly contributing to the development of new polymers or materials with specific properties, such as thermal stability or chemical resistance, based on the pyrazole ring's ability to form stable structures.
Used in Agrochemical Industry:
Ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate might also find use in the agrochemical sector, potentially as a component in the development of pesticides or herbicides, given the reactivity of the nitro group which can be important in the interaction with target organisms.
Check Digit Verification of cas no
The CAS Registry Mumber 5679-18-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,7 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5679-18:
(6*5)+(5*6)+(4*7)+(3*9)+(2*1)+(1*8)=125
125 % 10 = 5
So 5679-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N3O4/c1-4-16-8(13)5-11-7(3)9(12(14)15)6(2)10-11/h4-5H2,1-3H3
