56875-23-1 Usage
General Description
2-Azido-N,N-dimethylpropionamide is a chemical compound with the molecular formula C6H12N4O and a molecular weight of 140.18 g/mol. It is a potent azido-containing molecule, commonly used in the synthesis of pharmacologically active compounds. It has a variety of practical applications, including as a reagent for the preparation of amides and other organic compounds. This chemical is known for its ability to react with a range of functional groups, making it versatile for use in diverse chemical reactions. Its high reactivity and stability make it a valuable tool for medicinal chemistry research and drug development. Due to its unique properties and potential applications, 2-Azido-N,N-dimethylpropionamide is a valuable and widely studied compound in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 56875-23-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,8,7 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56875-23:
(7*5)+(6*6)+(5*8)+(4*7)+(3*5)+(2*2)+(1*3)=161
161 % 10 = 1
So 56875-23-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N4O/c1-4(7-8-6)5(10)9(2)3/h4H,1-3H3