56899-56-0 Usage
Uses
Used in Organic Chemistry:
N,N,N',N'-Tetramethylguanidinium Azide is used as a nucleophile and a base for facilitating organic reactions such as alkylation and acylation. Its nitrogen-rich functional group enhances its reactivity, making it a valuable component in the synthesis of various organic compounds.
Used in Laboratory Research:
Due to its potential explosiveness and reactivity, N,N,N',N'-Tetramethylguanidinium Azide is used as a research chemical in controlled laboratory settings. Trained professionals employ it to study its properties and explore its applications in organic synthesis and other chemical processes.
Used in Chemical Synthesis:
N,N,N',N'-Tetramethylguanidinium Azide is used as a reagent in the synthesis of complex organic molecules. Its unique properties allow for the formation of new chemical bonds and the creation of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 56899-56-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,8,9 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56899-56:
(7*5)+(6*6)+(5*8)+(4*9)+(3*9)+(2*5)+(1*6)=190
190 % 10 = 0
So 56899-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N3.N3/c1-7(2)5(6)8(3)4;1-3-2/h6H,1H2,2-4H3;/q+1;-1/b6-5-;
