56899-56-0 Usage
General Description
N,N,N',N'-Tetramethylguanidinium Azide is a chemical compound mostly used in the field of organic chemistry due to its unique properties. It acts as a strong nucleophile and a base and is often utilized in organic reactions such as alkylation and acylation. Classified as an azide, it contains a nitrogen-rich functional group which contributes to its reactivity. However, this same property makes it potentially explosive and requires careful handling and storage. It needs to be stored under a temperature of -20 degrees Celsius to maintain its stability and prevent decomposition. This chemical is commercially available, but due to its reactive nature, it's primarily used in controlled laboratory settings by trained professionals.
Check Digit Verification of cas no
The CAS Registry Mumber 56899-56-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,8,9 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56899-56:
(7*5)+(6*6)+(5*8)+(4*9)+(3*9)+(2*5)+(1*6)=190
190 % 10 = 0
So 56899-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N3.N3/c1-7(2)5(6)8(3)4;1-3-2/h6H,1H2,2-4H3;/q+1;-1/b6-5-;
