56960-82-8 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-3-nitro-5-chloro-6-picoline is used as an intermediate in the synthesis of pharmaceutical compounds. Its unique chemical structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicine and healthcare.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Amino-3-nitro-5-chloro-6-picoline is utilized as a building block for the creation of various agrochemicals. Its properties make it suitable for the development of pesticides, herbicides, and other agricultural chemicals, helping to improve crop protection and yield.
Used in Chemical Research:
2-Amino-3-nitro-5-chloro-6-picoline is also valuable in chemical research due to its unique properties and structure. Researchers use 2-AMINO-3-NITRO-5-CHLORO-6-PICOLINE to explore new chemical reactions, synthesis pathways, and potential applications in various fields, further expanding the understanding of chemistry and its practical uses.
Used in Environmental Monitoring:
As a potential environmental contaminant, 2-Amino-3-nitro-5-chloro-6-picoline is used in environmental monitoring to assess its presence and impact on aquatic organisms. This helps in understanding the ecological risks associated with 2-AMINO-3-NITRO-5-CHLORO-6-PICOLINE and aids in the development of strategies to mitigate its harmful effects on the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 56960-82-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,9,6 and 0 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 56960-82:
(7*5)+(6*6)+(5*9)+(4*6)+(3*0)+(2*8)+(1*2)=158
158 % 10 = 8
So 56960-82-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H6ClN3O2/c1-3-4(7)2-5(10(11)12)6(8)9-3/h2H,1H3,(H2,8,9)
56960-82-8Relevant academic research and scientific papers
8-aza, 6-aza and 6,8-diaza-1,4-dihydroquinoxaline-2,3-diones and the use thereof as antagonists for the glycine/NMDA receptor
-
, (2008/06/13)
Disclosed is a method of treating or preventing neuronal loss associated with stroke, ischemia, CNS trauma or hypoglycemia. The method comprises administering to an animal a compound of the formula: STR1 or a pharmaceutically acceptable salt thereof; wherein n is zero or 1; R 4, R 5, R 6 are independently hydrogen, nitro, amino, halo, haloalkyl, cyano, alkyl, cycloalkyl, alkenyl, alkynyl, azido, acylamino, alkylsulfonyl, aryl, substituted aryl, heteroaryl, alkoxy, trialkylsilyl-substituted alkoxy, aryloxy, substituted aryloxy, heteroaryloxy, a heterocyclic group, a heterocyclicoxy group, aralkoxy, or haloalkoxy; and R c and R d are defined in the specification. These compounds have high binding to the glycine site of the NMDA receptor.
