56961-81-0

Usage

Uses

Used in Pharmaceutical Research and Development:
8-Chloro-5-methylquinoline is used as a chemical intermediate for the synthesis of specialized pharmaceuticals or therapeutic substances. Its unique structure allows for the development of new compounds with potential medicinal properties.
Used in Laboratory Settings:
8-Chloro-5-methylquinoline is used as a research compound in various laboratory experiments. Its properties and reactivity can be studied to understand its potential applications and interactions with other compounds.
Used in Chemical Synthesis:
8-Chloro-5-methylquinoline is used as a building block in the synthesis of more complex chemical structures. Its presence in a molecule can influence the overall properties and reactivity of the final product, making it a valuable component in the creation of new materials and compounds.

InChI:InChI=1/C10H8ClN/c1-7-4-5-9(11)10-8(7)3-2-6-12-10/h2-6H,1H3

Upstream product

• 95-81-8 2-chloro-5-methylaniline 
• 56-81-5 glycerol 

Downstream Products

• 58960-02-4 5-methyl-1,2,3,4-tetrahydroquinoline 

Relevant academic research and scientific papers

Discovery of an Inhibitor of the Proteasome Subunit Rpn11

The proteasome plays a crucial role in degradation of normal proteins that happen to be constitutively or inducibly unstable, and in this capacity it plays a regulatory role. Additionally, it degrades abnormal/damaged/mutant/misfolded proteins, which serves a quality-control function. Inhibitors of the proteasome have been validated in the treatment of multiple myeloma, with several FDA-approved therapeutics. Rpn11 is a Zn2+-dependent metalloisopeptidase that hydrolyzes ubiquitin from tagged proteins that are trafficked to the proteasome for degradation. A fragment-based drug discovery (FBDD) approach was utilized to identify fragments with activity against Rpn11. Screening of a library of metal-binding pharmacophores (MBPs) revealed that 8-thioquinoline (8TQ, IC50 value ～2.5 μM) displayed strong inhibition of Rpn11. Further synthetic elaboration of 8TQ yielded a small molecule compound (35, IC50 value ～400 nM) that is a potent and selective inhibitor of Rpn11 that blocks proliferation of tumor cells in culture.

INHIBITORS OF RPN11

Candidate compounds for specific inhibition of Rpn11 are represented by Formula 1a where each of R2, R3, R4, R5, R6, and R7 is independently selected from hydrogen (H), substituted and unsubstituted alkyl groups, carboxyl groups, or substituted and unsubstituted carboxyamides.