56966-51-9 Usage
Uses
Used in Pharmaceutical Industry:
5-CHLORO-2-(3-METHYLPHENOXY)ANILINE is used as a pharmaceutical intermediate for the development of various biologically active compounds and pharmaceuticals. Its unique structure allows it to be a key component in the synthesis of drugs with potential therapeutic applications.
Used in Dye Manufacturing:
5-CHLORO-2-(3-METHYLPHENOXY)ANILINE is used as a building block in the manufacturing of dyes. Its chemical properties enable the creation of dyes with specific color characteristics and stability.
Used in Agrochemical Production:
In the agrochemical industry, 5-CHLORO-2-(3-METHYLPHENOXY)ANILINE is utilized as an intermediate for the synthesis of various agrochemicals. Its presence in these compounds can contribute to their effectiveness in agricultural applications.
Used in Polymer Production:
5-CHLORO-2-(3-METHYLPHENOXY)ANILINE is also used in the production of polymers. Its incorporation into polymer structures can enhance their properties, such as strength, durability, or chemical resistance.
Used in Organic Synthesis:
As a versatile chemical compound, 5-CHLORO-2-(3-METHYLPHENOXY)ANILINE is employed in organic synthesis for the creation of a wide range of organic compounds with diverse applications across various industries.
It is crucial to handle 5-CHLORO-2-(3-METHYLPHENOXY)ANILINE with care due to its potential health hazards and environmental risks if not properly managed.
Check Digit Verification of cas no
The CAS Registry Mumber 56966-51-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,9,6 and 6 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 56966-51:
(7*5)+(6*6)+(5*9)+(4*6)+(3*6)+(2*5)+(1*1)=169
169 % 10 = 9
So 56966-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H12ClNO/c1-9-3-2-4-11(7-9)16-13-6-5-10(14)8-12(13)15/h2-8H,15H2,1H3
