5699-67-2 Usage
Uses
Used in Pharmaceutical Industry:
Argininehydroxamic acid is used as a pharmaceutical agent for its potential therapeutic effects. It has been found to have inhibitory activity against certain enzymes and microbial pathogens, making it a promising candidate for the development of drugs to treat various diseases.
Used in Research Applications:
Argininehydroxamic acid is used as a research tool in biochemical and medicinal chemistry studies. It serves as an inhibitor of specific enzymes, such as matrix metalloproteinases (MMPs) and urokinase plasminogen activator (uPA), which are involved in various physiological processes and disease pathways. By studying the interactions of argininehydroxamic acid with these enzymes, researchers can gain insights into their mechanisms of action and develop more effective drugs targeting them.
Used in Chemical Synthesis:
Argininehydroxamic acid can be used as a building block in the synthesis of various organic compounds and pharmaceuticals. Its unique structure allows for the formation of different chemical bonds and reactions, making it a versatile component in the creation of new molecules with potential applications in medicine, agriculture, and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5699-67-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,9 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5699-67:
(6*5)+(5*6)+(4*9)+(3*9)+(2*6)+(1*7)=142
142 % 10 = 2
So 5699-67-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H15N5O2/c7-4(5(12)11-13)2-1-3-10-6(8)9/h4,13H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1
