57119-83-2 Usage
Structure
Complex and intricate, containing multiple functional groups
Functional Groups
Acetate: Confers acetyl functionality, potentially useful in organic synthesis and as a leaving group in reactions.
Bromo: Bromine substitution, can be involved in various substitution reactions.
Nitro: Nitro group adds electron-withdrawing properties, impacting reactivity and potentially used in synthesis.
Azo: Azo linkage provides color and can be involved in dye synthesis.
Naphthyl: Aromatic ring system, contributes to the compound's overall structure and reactivity.
Ethoxy: Ethoxy group enhances reactivity and solubility, potentially useful in organic synthesis and pharmaceutical applications.
Versatility
Due to its diverse functional groups, the compound can be applied in various fields including organic synthesis, dye synthesis, and pharmaceuticals.
Reactivity
The presence of multiple functional groups suggests high reactivity, making it suitable for a wide range of chemical reactions.
Potential Applications
Organic Synthesis: Utilized as a building block or reagent in the synthesis of more complex molecules.
Dye Synthesis: Azo group contributes to potential applications in dye synthesis, imparting color to materials.
Pharmaceuticals: Functional groups may confer bioactivity or reactivity useful in pharmaceutical development.
Industrial and Scientific Applications
The compound's complex structure and functional groups make it applicable in various industrial and scientific contexts, offering opportunities for innovation and research.
Check Digit Verification of cas no
The CAS Registry Mumber 57119-83-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,1,1 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57119-83:
(7*5)+(6*7)+(5*1)+(4*1)+(3*9)+(2*8)+(1*3)=132
132 % 10 = 2
So 57119-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H20BrN5O7/c1-14(29)35-11-10-34-9-8-24-19-6-7-20(17-5-3-2-4-16(17)19)25-26-22-18(23)12-15(27(30)31)13-21(22)28(32)33/h2-7,12-13,24H,8-11H2,1H3/b26-25+